Online Database of Chemicals from Around the World
|
CAS#: 73473-54-8 Product: 6beta,7alpha-Dihydrobenz(1,10)Acephenanthryleno(4,5-b)Oxirene No suppilers available for the product. |
| Name | 6beta,7alpha-Dihydrobenz(1,10)Acephenanthryleno(4,5-b)Oxirene |
|---|---|
| Synonyms | Brn 3616512; Benz(1,10)Acephenanthryleno(4,5-B)Oxirene, 6B,7A-Dihydro-; Cyclopenta(Cd)Pyrene 3,4-Oxide |
| Molecular Structure |  |
| Molecular Formula | C18H10O |
| Molecular Weight | 242.28 |
| CAS Registry Number | 73473-54-8 |
| SMILES | C1=CC5=C4C2=C1C=CC3=C2C(=CC=C3)C=C4C6OC56 |
| InChI | 1S/C18H10O/c1-2-9-4-5-10-6-7-12-16-13(18-17(12)19-18)8-11(3-1)14(9)15(10)16/h1-8,17-18H |
| InChIKey | IHWWMRTWJKYVEY-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.57°C at 760 mmHg (Cal.) |
| Flash point | 229.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6beta,7alpha-Dihydrobenz(1,10)Acephenanthryleno(4,5-b)Oxirene |