Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 3,4-Dihydrobenz[a]Anthracen-1(2H)-One |
|---|---|
| Synonyms | 3,4-Dihydrobenz(A)Anthracen-1(2H)-One; 188166_Aldrich |
| Molecular Structure | ![CAS#: 57652-74-1， 3,4-Dihydrobenz[a]Anthracen-1(2H)-One](/moreStructures/57652-74-1.gif) |
| Molecular Formula | C18H14O |
| Molecular Weight | 246.31 |
| CAS Registry Number | 57652-74-1 |
| EINECS | 260-883-5 |
| SMILES | C2=C1C4=C(C=CC1=CC3=CC=CC=C23)CCCC4=O |
| InChI | 1S/C18H14O/c19-17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17/h1-2,4-5,8-11H,3,6-7H2 |
| InChIKey | LVBDYVLCOBUBNZ-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.245°C at 760 mmHg (Cal.) |
| Flash point | 207.309°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydrobenz[a]Anthracen-1(2H)-One |