Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Noxiptiline |
|---|---|
| Synonyms | Elronon; Nogedal |
| Molecular Structure |  |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 |
| CAS Registry Number | 3362-45-6 |
| EINECS | 225-638-9 |
| SMILES | C3=C2C(=NOCC[NH+](C)C)C1=CC=CC=C1CCC2=CC=C3.[Cl-] |
| InChI | 1S/C19H22N2O.ClH/c1-21(2)13-14-22-20-19-17-9-5-3-7-15(17)11-12-16-8-4-6-10-18(16)19;/h3-10H,11-14H2,1-2H3;1H |
| InChIKey | JIKBYFBMUAUPJS-UHFFFAOYSA-N |
| Boiling point | 415.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Noxiptiline |