Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 | www.bocsci.com | |||
 | +1 (631) 485-4226 | |||
 | +1 (631) 614-7828 | |||
 | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Standard >> Analytical standard |
|---|---|
| Name | 2-NP-Sca 13C,15N2 |
| Synonyms | [(E)-(2-nitrophenyl)methylideneamino](13C)urea |
| Molecular Structure |  |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 211.15 |
| CAS Registry Number | 957509-32-9 |
| SMILES | C1=CC=C(C(=C1)/C=[15N]/[15NH][13C](=O)N)[N+](=O)[O-] |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.645, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-NP-Sca 13C,15N2 |