|
CAS#: 7685-72-5 Product: N-O-Nps-L -Asparagine No suppilers available for the product. |
| Name | N-O-Nps-L -Asparagine |
|---|---|
| Synonyms | (2S)-4-Amino-2-[(2-Nitrophenyl)Sulfanylamino]-4-Oxo-Butanoic Acid; (2S)-4-Amino-2-[[(2-Nitrophenyl)Thio]Amino]-4-Oxobutanoic Acid; (2S)-4-Amino-4-Keto-2-[[(2-Nitrophenyl)Thio]Amino]Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.27 |
| CAS Registry Number | 7685-72-5 |
| EINECS | 231-694-5 |
| SMILES | [C@@H](NSC1=C([N+]([O-])=O)C=CC=C1)(C(=O)O)CC(=O)N |
| InChI | 1S/C10H11N3O5S/c11-9(14)5-6(10(15)16)12-19-8-4-2-1-3-7(8)13(17)18/h1-4,6,12H,5H2,(H2,11,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | SCYCMFQAMTUOEU-LURJTMIESA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 592.952°C at 760 mmHg (Cal.) |
| Flash point | 312.407°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-O-Nps-L -Asparagine |