Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5,6-Dichlorobenzotriazole |
|---|---|
| Synonyms | Nsc90977; Nciopen2_001568 |
| Molecular Structure |  |
| Molecular Formula | C6H3Cl2N3 |
| Molecular Weight | 188.02 |
| CAS Registry Number | 34374-67-9 |
| SMILES | C1=C(Cl)C(=CC2=N[NH]N=C12)Cl |
| InChI | 1S/C6H3Cl2N3/c7-3-1-5-6(2-4(3)8)10-11-9-5/h1-2H,(H,9,10,11) |
| InChIKey | HHEBHJLYNLALHM-UHFFFAOYSA-N |
| Density | 1.675g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.137°C at 760 mmHg (Cal.) |
| Flash point | 198.453°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dichlorobenzotriazole |