Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4,7-Dichlorobenzo[b]Thiophene-3(2H)-One |
|---|---|
| Synonyms | 4,7-Dichlorobenzothiophen-3-One; 4,7-Dichloro-3-Benzothiophenone; 4,7-Dichlorobenzo(B)Thiophene-3(2H)-One |
| Molecular Structure | ![CAS#: 61886-43-9， 4,7-Dichlorobenzo[b]Thiophene-3(2H)-One](/moreStructures/61886-43-9.gif) |
| Molecular Formula | C8H4Cl2OS |
| Molecular Weight | 219.09 |
| CAS Registry Number | 61886-43-9 |
| EINECS | 263-291-5 |
| SMILES | C2=C(C1=C(C(=O)CS1)C(=C2)Cl)Cl |
| InChI | 1S/C8H4Cl2OS/c9-4-1-2-5(10)8-7(4)6(11)3-12-8/h1-2H,3H2 |
| InChIKey | RXBGQMAHSXLVLU-UHFFFAOYSA-N |
| Density | 1.583g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.585°C at 760 mmHg (Cal.) |
| Flash point | 167.037°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,7-Dichlorobenzo[b]Thiophene-3(2H)-One |