Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2.3-Dichlorobenzotrichloride |
|---|---|
| Synonyms | Dichlorobenzotrichloride; Einecs 250-861-3 |
| Molecular Structure |  |
| Molecular Formula | C7H3Cl5 |
| Molecular Weight | 264.37 |
| CAS Registry Number | 84613-97-8 |
| EINECS | 283-395-4 |
| SMILES | C1=CC=C(C(=C1Cl)Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C7H3Cl5/c8-5-3-1-2-4(6(5)9)7(10,11)12/h1-3H |
| InChIKey | GKGPLSQWIBJJPC-UHFFFAOYSA-N |
| Density | 1.606g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.67°C at 760 mmHg (Cal.) |
| Flash point | 129.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2.3-Dichlorobenzotrichloride |