Online Database of Chemicals from Around the World
|
CAS#: 35245-80-8 Product: 2,3,4,5-Tetrachloro-6-(2,3,4,5,6-Pentachlorophenoxy)Phenol No suppilers available for the product. |
| Name | 2,3,4,5-Tetrachloro-6-(2,3,4,5,6-Pentachlorophenoxy)Phenol |
|---|---|
| Synonyms | 2,3,4,5-Tetrachloro-6-(Pentachlorophenoxy)Phenol; 2-Hydroxy-Nonachlorodiphenyl Ether; 3,4,5,6-Tetrachloro-2-(Pentachlorophenoxy)Phenol |
| Molecular Structure |  |
| Molecular Formula | C12HCl9O2 |
| Molecular Weight | 496.22 |
| CAS Registry Number | 35245-80-8 |
| SMILES | C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)OC2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)O)Cl |
| InChI | 1S/C12HCl9O2/c13-1-3(15)7(19)11(8(20)4(1)16)23-12-9(21)5(17)2(14)6(18)10(12)22/h22H |
| InChIKey | AZNDXYXXGIGVCZ-UHFFFAOYSA-N |
| Density | 1.865g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.684°C at 760 mmHg (Cal.) |
| Flash point | 225.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5-Tetrachloro-6-(2,3,4,5,6-Pentachlorophenoxy)Phenol |