Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,3,5,6-Tetrachlorophenol Acetate |
|---|---|
| Synonyms | Acetic Acid (2,3,5,6-Tetrachlorophenyl) Ester; (2,3,5,6-Tetrachlorophenyl) Ethanoate; 2,3,5,6-Tetrachlorophenol Acetate |
| Molecular Structure |  |
| Molecular Formula | C8H4Cl4O2 |
| Molecular Weight | 273.93 |
| CAS Registry Number | 61925-90-4 |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)OC(=O)C)Cl)Cl |
| InChI | 1S/C8H4Cl4O2/c1-3(13)14-8-6(11)4(9)2-5(10)7(8)12/h2H,1H3 |
| InChIKey | NHBOZDKIYJWIIT-UHFFFAOYSA-N |
| Density | 1.567g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.48°C at 760 mmHg (Cal.) |
| Flash point | 145.957°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6-Tetrachlorophenol Acetate |