Online Database of Chemicals from Around the World
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (843)-884-4911 | |||
 |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Acridine-9-Carboxamide |
|---|---|
| Synonyms | 9-Acridinecarboxamide; Nsc49384; Zinc04362975 |
| Molecular Structure |  |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 |
| CAS Registry Number | 35417-96-0 |
| SMILES | C2=CC=CC3=NC1=CC=CC=C1C(=C23)C(=O)N |
| InChI | 1S/C14H10N2O/c15-14(17)13-9-5-1-3-7-11(9)16-12-8-4-2-6-10(12)13/h1-8H,(H2,15,17) |
| InChIKey | QBFNAVMTMIICEI-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.959°C at 760 mmHg (Cal.) |
| Flash point | 262.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acridine-9-Carboxamide |