Online Database of Chemicals from Around the World
| Name | 4-Benzoylisophthalic Acid |
|---|---|
| Synonyms | 4-(Oxo-Phenylmethyl)Benzene-1,3-Dicarboxylic Acid; 4-(Benzoyl)Isophthalic Acid; 4-Phenylcarbonylbenzene-1,3-Dicarboxylic Acid |
| Molecular Structure |  |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 40786-99-0 |
| SMILES | C1=C(C(O)=O)C=CC(=C1C(O)=O)C(=O)C2=CC=CC=C2 |
| InChI | 1S/C15H10O5/c16-13(9-4-2-1-3-5-9)11-7-6-10(14(17)18)8-12(11)15(19)20/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | IPRJQOGCIFOIBA-UHFFFAOYSA-N |
| Density | 1.403g/cm3 (Cal.) |
|---|---|
| Boiling point | 553.071°C at 760 mmHg (Cal.) |
| Flash point | 302.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Benzoylisophthalic Acid |
