| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Serine derivative |
|---|---|
| Name | DL-N-Benzoyl-2-Isopropylserine |
| Synonyms | (2R)-2-(Benzoylamino)-2-(Hydroxymethyl)-3-Methyl-Butanoate; (2R)-2-(Hydroxymethyl)-3-Methyl-2-[(Oxo-Phenylmethyl)Amino]Butanoate; (2R)-2-(Benzoylamino)-3-Methyl-2-Methylol-Butyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16NO4 |
| Molecular Weight | 250.27 |
| CAS Registry Number | 52421-46-2 |
| SMILES | [C@](NC(=O)C1=CC=CC=C1)(C(C)C)(CO)C([O-])=O |
| InChI | 1S/C13H17NO4/c1-9(2)13(8-15,12(17)18)14-11(16)10-6-4-3-5-7-10/h3-7,9,15H,8H2,1-2H3,(H,14,16)(H,17,18)/p-1/t13-/m0/s1 |
| InChIKey | LNEDAIGVCSVPDM-ZDUSSCGKSA-M |
| Boiling point | 511.662°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 263.244°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for DL-N-Benzoyl-2-Isopropylserine |