| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Serine derivative |
|---|---|
| Name | DL-N-Benzoyl-2-Isobutylserine |
| Synonyms | (2R)-2-(Benzoylamino)-2-(Hydroxymethyl)-4-Methyl-Pentanoate; (2R)-2-(Hydroxymethyl)-4-Methyl-2-[(Oxo-Phenylmethyl)Amino]Pentanoate; (2R)-2-(Benzoylamino)-4-Methyl-2-Methylol-Valerate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18NO4 |
| Molecular Weight | 264.30 |
| CAS Registry Number | 52421-47-3 |
| SMILES | [C@](NC(=O)C1=CC=CC=C1)(CC(C)C)(CO)C([O-])=O |
| InChI | 1S/C14H19NO4/c1-10(2)8-14(9-16,13(18)19)15-12(17)11-6-4-3-5-7-11/h3-7,10,16H,8-9H2,1-2H3,(H,15,17)(H,18,19)/p-1/t14-/m1/s1 |
| InChIKey | FKUCELLBHQAFFX-CQSZACIVSA-M |
| Boiling point | 516.846°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 266.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for DL-N-Benzoyl-2-Isobutylserine |