| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Fenofibrate EP Impurity E |
|---|---|
| Synonyms | Ethyl 2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H19ClO4 |
| Molecular Weight | 346.80 |
| CAS Registry Number | 42019-08-9 |
| EC Number | 642-148-4 |
| SMILES | CCOC(=O)C(C)(C)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl |
| Solubility | 0.541 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.552, Calc.* |
| Melting point | 156.29 °C |
| Boiling Point | 419.87 °C, 463.1±35.0 °C (760 mmHg), Calc.* |
| Flash Point | 167.9±24.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Fenofibrate EP Impurity E |