Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (831) 457-3800 | |||
|
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | Fenofibric Acid, Hydroxymethyl |
|---|---|
| Synonyms | 2-[4-[(4-Chlorophenyl)-Hydroxy-Methyl]Phenoxy]-2-Methyl-Propanoic Acid; 2-[4-[(4-Chlorophenyl)-Hydroxy-Methyl]Phenoxy]-2-Methyl-Propionic Acid; 2-(4-(4-Chloro-Alpha-Hydroxybenzyl)Phenoxy)-2-Methylpropanoic Acid |
| Molecular Structure |  |
| Molecular Formula | C17H17ClO4 |
| Molecular Weight | 320.77 |
| CAS Registry Number | 54419-31-7 |
| SMILES | C1=C(OC(C(O)=O)(C)C)C=CC(=C1)C(C2=CC=C(Cl)C=C2)O |
| InChI | 1S/C17H17ClO4/c1-17(2,16(20)21)22-14-9-5-12(6-10-14)15(19)11-3-7-13(18)8-4-11/h3-10,15,19H,1-2H3,(H,20,21) |
| InChIKey | ASDCLYXOQCGHNT-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.299°C at 760 mmHg (Cal.) |
| Flash point | 256.372°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fenofibric Acid, Hydroxymethyl |