Online Database of Chemicals from Around the World
|
CAS#: 448-70-4 Product: 2,8,12,18-Tetraethyl-3,7,13,17-Tetramethyl-21H,23H-Porphyrin No suppilers available for the product. |
| Name | 2,8,12,18-Tetraethyl-3,7,13,17-Tetramethyl-21H,23H-Porphyrin |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C32H38N4 |
| Molecular Weight | 478.68 |
| CAS Registry Number | 448-70-4 |
| SMILES | C(C1=C2[NH]C(=C1C)C=C5[NH]C(=CC4=NC(=CC3=NC(=C2)C(=C3C)CC)C(=C4CC)C)C(=C5C)CC)C |
| InChI | 1S/C32H38N4/c1-9-21-17(5)25-13-26-19(7)23(11-3)31(35-26)16-32-24(12-4)20(8)28(36-32)14-27-18(6)22(10-2)30(34-27)15-29(21)33-25/h13-16,33,35H,9-12H2,1-8H3 |
| InChIKey | DARISIXPASSGJN-UHFFFAOYSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 797.948°C at 760 mmHg (Cal.) |
| Flash point | 341.27°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,8,12,18-Tetraethyl-3,7,13,17-Tetramethyl-21H,23H-Porphyrin |