Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Chem Service, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (610) 692-3026 | |||
|
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Name | Tetraethyl thioonopyrophosphate |
|---|---|
| Synonyms | Phosphoric Acid Diethoxyphosphinothioyl Diethyl Ester; Phosphoric Acid Diethoxythiophosphoryl Diethyl Ester; Fosarbin |
| Molecular Structure |  |
| Molecular Formula | C8H20O6P2S |
| Molecular Weight | 306.25 |
| CAS Registry Number | 645-78-3 |
| SMILES | C(O[P](=S)(OCC)O[P](=O)(OCC)OCC)C |
| InChI | 1S/C8H20O6P2S/c1-5-10-15(9,11-6-2)14-16(17,12-7-3)13-8-4/h5-8H2,1-4H3 |
| InChIKey | QPXWUAQRJLSJRT-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.573°C at 760 mmHg (Cal.) |
| Flash point | 139.815°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetraethyl thioonopyrophosphate |