Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Tetraethyl 2-(2-thienyl)-1,1,3,3-propanetetracarboxylate |
|---|---|
| Synonyms | tetraethyl 2-(2-thienyl)propane-1,1,3,3-tetracarboxylate; ZINC04289157 |
| Molecular Structure |  |
| Molecular Formula | C19H26O8S |
| Molecular Weight | 414.47 |
| CAS Registry Number | 680215-57-0 |
| SMILES | O=C(OCC)C(C(=O)OCC)C(c1sccc1)C(C(=O)OCC)C(=O)OCC |
| InChI | 1S/C19H26O8S/c1-5-24-16(20)14(17(21)25-6-2)13(12-10-9-11-28-12)15(18(22)26-7-3)19(23)27-8-4/h9-11,13-15H,5-8H2,1-4H3 |
| InChIKey | NCTCUJPYKLGLLO-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.984°C at 760 mmHg (Cal.) |
| Flash point | 237.433°C (Cal.) |
| Refractive index | 1.505 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetraethyl 2-(2-thienyl)-1,1,3,3-propanetetracarboxylate |