Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-[1-(2-Nitrophenyl)Ethyl]Urea |
|---|---|
| Synonyms | 1-(1-(2-Nitrophenyl)ethyl)urea; 1-[1-(2-Nitrophenyl)ethyl]harnstoff; 1-[1-(2-Nitrophenyl)ethyl]urea |
| Molecular Structure | ![CAS#: 482576-65-8， 1-[1-(2-Nitrophenyl)Ethyl]Urea](/moreStructures/482576-65-8.gif) |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 482576-65-8 |
| SMILES | CC(c1ccccc1[N+](=O)[O-])NC(=O)N |
| InChI | 1S/C9H11N3O3/c1-6(11-9(10)13)7-4-2-3-5-8(7)12(14)15/h2-6H,1H3,(H3,10,11,13) |
| InChIKey | RPTYLMDRHRHLFE-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.4±34.0°C at 760 mmHg (Cal.) |
| Flash point | 188.1±25.7°C (Cal.) |
| Refractive index | 1.588 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[1-(2-Nitrophenyl)Ethyl]Urea |