Online Database of Chemicals from Around the World
|
CAS#: 90870-20-5 Product: 4-Nitrophenyl ethyl(methyl)carbamate No suppilers available for the product. |
| Name | 4-Nitrophenyl ethyl(methyl)carbamate |
|---|---|
| Synonyms | 4-Nitrophenyl ethyl(methyl)carbamate; 4-Nitrophenyl-ethyl(methyl)carbamat; Carbamic acid, N-ethyl-N-methyl-, 4-nitrophenyl ester |
| Molecular Structure |  |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.21 |
| CAS Registry Number | 90870-20-5 |
| SMILES | CCN(C)C(=O)Oc1ccc(cc1)[N+](=O)[O-] |
| InChI | 1S/C10H12N2O4/c1-3-11(2)10(13)16-9-6-4-8(5-7-9)12(14)15/h4-7H,3H2,1-2H3 |
| InChIKey | FDXHDTIKCTZVEG-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.2±34.0°C at 760 mmHg (Cal.) |
| Flash point | 160.7±25.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenyl ethyl(methyl)carbamate |