|
CAS#: 51626-47-2 Product: 3-(2-Nitro-1-Phenyl-Ethyl)-1H-Indole No suppilers available for the product. |
| Name | 3-(2-Nitro-1-Phenyl-Ethyl)-1H-Indole |
|---|---|
| Synonyms | 3-[(1R)-2-Nitro-1-Phenyl-Ethyl]-1H-Indole; Zinc00053345 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 51626-47-2 |
| SMILES | [C@H](C1=C[NH]C2=C1C=CC=C2)(C3=CC=CC=C3)C[N+]([O-])=O |
| InChI | 1S/C16H14N2O2/c19-18(20)11-15(12-6-2-1-3-7-12)14-10-17-16-9-5-4-8-13(14)16/h1-10,15,17H,11H2/t15-/m1/s1 |
| InChIKey | NTQBCZPFTAELGC-OAHLLOKOSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.171°C at 760 mmHg (Cal.) |
| Flash point | 244.804°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(2-Nitro-1-Phenyl-Ethyl)-1H-Indole |