Online Database of Chemicals from Around the World
|
CAS#: 6451-12-3 Product: [2,2'-Bianthra[2,1-d]Thiazole]-6,6',11,11'-Tetrone No suppilers available for the product. |
| Name | [2,2'-Bianthra[2,1-d]Thiazole]-6,6',11,11'-Tetrone |
|---|---|
| Molecular Structure | ![CAS#: 6451-12-3， [2,2'-Bianthra[2,1-d]Thiazole]-6,6',11,11'-Tetrone](/moreStructures/6451-12-3.gif) |
| Molecular Formula | C30H12N2O4S2 |
| Molecular Weight | 528.56 |
| CAS Registry Number | 6451-12-3 |
| EINECS | 229-252-1 |
| SMILES | C2=C8C(=C1SC(=NC1=C2)C4=NC3=CC=C6C(=C3S4)C(C5=CC=CC=C5C6=O)=O)C(C7=CC=CC=C7C8=O)=O |
| InChI | 1S/C30H12N2O4S2/c33-23-13-5-1-3-7-15(13)25(35)21-17(23)9-11-19-27(21)37-29(31-19)30-32-20-12-10-18-22(28(20)38-30)26(36)16-8-4-2-6-14(16)24(18)34/h1-12H |
| InChIKey | VYPILCHHNHVAAE-UHFFFAOYSA-N |
| Density | 1.613g/cm3 (Cal.) |
|---|---|
| Boiling point | 812.705°C at 760 mmHg (Cal.) |
| Flash point | 445.308°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2,2'-Bianthra[2,1-d]Thiazole]-6,6',11,11'-Tetrone |