| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3S,6S)-3-Isopropyl-6-Methyl-2-Piperazinone |
|---|---|
| Synonyms | (3S,6S)-3-isopropyl-6-methylpiperazin-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 |
| CAS Registry Number | 509149-18-2 |
| SMILES | O/C1=N/[C@@H](C)CN[C@H]1C(C)C |
| InChI | 1S/C8H16N2O/c1-5(2)7-8(11)10-6(3)4-9-7/h5-7,9H,4H2,1-3H3,(H,10,11)/t6-,7-/m0/s1 |
| InChIKey | MANYTVBDDBVVOI-BQBZGAKWSA-N |
| Density | 1.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.807°C at 760 mmHg (Cal.) |
| Flash point | 113.952°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| (1) | P. Sawatzki, T. Mikeska, K. Sandhoff, M. Nieger and T. Kolter. 6(S)-Methyl-3(S)-(1-methylethyl)piperazin-2-one, Acta Cryst. (2003). E59, o171-o173 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3S,6S)-3-Isopropyl-6-Methyl-2-Piperazinone |