Online Database of Chemicals from Around the World
| Name | 5-(Isopropyl)-4-Methylphthalic Acid |
|---|---|
| Synonyms | 4-Isopropyl-5-Methyl-Phthalic Acid; 4-Isopropyl-5-Methylphthalic Acid; 4-Methyl-5-Propan-2-Yl-Phthalic Acid |
| Molecular Structure |  |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 84029-87-8 |
| EINECS | 281-758-1 |
| SMILES | C1=C(C(C)C)C(=CC(=C1C(=O)O)C(=O)O)C |
| InChI | 1S/C12H14O4/c1-6(2)8-5-10(12(15)16)9(11(13)14)4-7(8)3/h4-6H,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | JXJMQLWUVREZGB-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.148°C at 760 mmHg (Cal.) |
| Flash point | 204.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Isopropyl)-4-Methylphthalic Acid |
