Online Database of Chemicals from Around the World
|
CAS#: 84029-86-7 Product: 5-Isopropyl-4-Methylphthalic Anhydride No suppilers available for the product. |
| Name | 5-Isopropyl-4-Methylphthalic Anhydride |
|---|---|
| Synonyms | 5-Isopropyl-6-Methyl-Isobenzofuran-1,3-Dione; 5-Isopropyl-6-Methylisobenzofuran-1,3-Dione; 5-Isopropyl-6-Methyl-Isobenzofuran-1,3-Quinone |
| Molecular Structure |  |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 |
| CAS Registry Number | 84029-86-7 |
| EINECS | 281-757-6 |
| SMILES | C1=C(C(C)C)C(=CC2=C1C(OC2=O)=O)C |
| InChI | 1S/C12H12O3/c1-6(2)8-5-10-9(4-7(8)3)11(13)15-12(10)14/h4-6H,1-3H3 |
| InChIKey | HARMCMJYOSSBBK-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.663°C at 760 mmHg (Cal.) |
| Flash point | 164.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Isopropyl-4-Methylphthalic Anhydride |