Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,3',4,4'-Tetrachloro-(1,1'-biphenyl)-3-ol |
|---|---|
| Synonyms | (1,1'-Biphenyl)-3-Ol, 2,3',4,4'-Tetrachloro-; 2,3',4,4'-Tetrachloro-(1,1'-Biphenyl)-3-Ol; 5-Hydroxy-2,4,3',4'-Tcb |
| Molecular Structure |  |
| Molecular Formula | C12H6Cl4O |
| Molecular Weight | 307.99 |
| CAS Registry Number | 51109-11-6 |
| SMILES | C1=C(C(=CC=C1C2=C(C(=C(C=C2)Cl)O)Cl)Cl)Cl |
| InChI | 1S/C12H6Cl4O/c13-8-3-1-6(5-10(8)15)7-2-4-9(14)12(17)11(7)16/h1-5,17H |
| InChIKey | BKAFWWPAYSNNLG-UHFFFAOYSA-N |
| Density | 1.533g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.167°C at 760 mmHg (Cal.) |
| Flash point | 187.952°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3',4,4'-Tetrachloro-(1,1'-biphenyl)-3-ol |