Online Database of Chemicals from Around the World
|
CAS#: 68099-35-4 Product: 2,2',5,5'-Tetrachlorobiphenyl 3,4-Oxide No suppilers available for the product. |
| Name | 2,2',5,5'-Tetrachlorobiphenyl 3,4-Oxide |
|---|---|
| Synonyms | 2,2',5,5'-Tetrachlorobiphenyl 3,4-Oxide; 2,5,2',5'-Tetrachlorobiphenyl 3,4-Oxide; 2,5-Dichloro-3-(2,5-Dichlorophenyl)-7-Oxabicyclo(4.1.0)Hepta-2,4-Diene |
| Molecular Structure |  |
| Molecular Formula | C12H6Cl4O |
| Molecular Weight | 307.99 |
| CAS Registry Number | 68099-35-4 |
| SMILES | C1=CC(=CC(=C1Cl)C3=C(C2OC2C(=C3)Cl)Cl)Cl |
| InChI | 1S/C12H6Cl4O/c13-5-1-2-8(14)6(3-5)7-4-9(15)11-12(17-11)10(7)16/h1-4,11-12H |
| InChIKey | HUWUGZREAZTGIP-UHFFFAOYSA-N |
| Density | 1.622g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.332°C at 760 mmHg (Cal.) |
| Flash point | 169.055°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',5,5'-Tetrachlorobiphenyl 3,4-Oxide |