Online Database of Chemicals from Around the World
|
CAS#: 518-77-4 Product: Corybulbine No suppilers available for the product. |
| Name | Corybulbine |
|---|---|
| Synonyms | 13Abeta-Berbin-3-Ol, 2,9,10-Trimethoxy-13Alpha-Methyl-; Corybulbin; Corybulbine |
| Molecular Structure |  |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 |
| CAS Registry Number | 518-77-4 |
| SMILES | [C@H]13N(CC2=C([C@H]1C)C=CC(=C2OC)OC)CCC4=CC(=C(C=C34)OC)O |
| InChI | 1S/C21H25NO4/c1-12-14-5-6-18(24-2)21(26-4)16(14)11-22-8-7-13-9-17(23)19(25-3)10-15(13)20(12)22/h5-6,9-10,12,20,23H,7-8,11H2,1-4H3/t12-,20+/m1/s1 |
| InChIKey | OBVLTWCOTSTMNM-ODXCJYRJSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.406°C at 760 mmHg (Cal.) |
| Flash point | 255.227°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Corybulbine |