|
CAS#: 667-65-2 Product: beta-Cortol No suppilers available for the product. |
| Name | beta-Cortol |
|---|---|
| Synonyms | Nsc58792; Pregnane-3,11,17,20,21-Pentol, (3.Alpha.,5.Beta.,11.Beta.,20R)- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 |
| CAS Registry Number | 667-65-2 |
| SMILES | [C@@]14(C)[C@H]([C@H]2[C@H]([C@H](C1)O)[C@]3(C)[C@H](CC2)C[C@@H](CC3)O)CC[C@@]4([C@@H](CO)O)O |
| InChI | 1S/C21H36O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h12-18,22-26H,3-11H2,1-2H3/t12-,13-,14+,15+,16+,17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | FFPUNPBUZDTHJI-ZFOKFBPFSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.528°C at 760 mmHg (Cal.) |
| Flash point | 254.999°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Cortol |