Online Database of Chemicals from Around the World
|
CAS#: 521-93-7 Product: corycavidine No suppilers available for the product. |
| Name | corycavidine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 |
| CAS Registry Number | 521-93-7 |
| SMILES | O=C2c3cc4OCOc4cc3CCN(C)Cc1c(ccc(OC)c1OC)[C@H]2C |
| InChI | 1S/C22H25NO5/c1-13-15-5-6-18(25-3)22(26-4)17(15)11-23(2)8-7-14-9-19-20(28-12-27-19)10-16(14)21(13)24/h5-6,9-10,13H,7-8,11-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | YRAXYDGEEARNTF-CYBMUJFWSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 548.229°C at 760 mmHg (Cal.) |
| Flash point | 285.359°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for corycavidine |