Online Database of Chemicals from Around the World
| Name | Tris(Chloropropyl) Thiophosphate |
|---|---|
| Synonyms | Tris(1-Chloropropoxy)-Thioxo-Phosphorane; Tris(1-Chloropropoxy)-Thioxophosphorane; Tris(1-Chloropropoxy)-Sulfanylidene-Phosphorane |
| Molecular Structure |  |
| Molecular Formula | C9H18Cl3O3PS |
| Molecular Weight | 343.63 |
| CAS Registry Number | 52797-93-0 |
| EINECS | 258-196-0 |
| SMILES | C(C(Cl)O[P](=S)(OC(Cl)CC)OC(Cl)CC)C |
| InChI | 1S/C9H18Cl3O3PS/c1-4-7(10)13-16(17,14-8(11)5-2)15-9(12)6-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | YGGGUVQNCJIRAW-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.629°C at 760 mmHg (Cal.) |
| Flash point | 154.969°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(Chloropropyl) Thiophosphate |
