Online Database of Chemicals from Around the World
|
CAS#: 53718-28-8 Product: 1,1,3,3,6-Pentamethylindan-4-Ol No suppilers available for the product. |
| Name | 1,1,3,3,6-Pentamethylindan-4-Ol |
|---|---|
| Synonyms | 1,1,3,3,6-Pentamethylindan-4-Ol; 1,1,3,3,6-Pentamethyl-4-Indanol |
| Molecular Structure |  |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 53718-28-8 |
| EINECS | 258-717-1 |
| SMILES | C1=C(C=C(C2=C1C(CC2(C)C)(C)C)O)C |
| InChI | 1S/C14H20O/c1-9-6-10-12(11(15)7-9)14(4,5)8-13(10,2)3/h6-7,15H,8H2,1-5H3 |
| InChIKey | KNNNLBDLVODXDQ-UHFFFAOYSA-N |
| Density | 0.973g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.415°C at 760 mmHg (Cal.) |
| Flash point | 129.269°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3,3,6-Pentamethylindan-4-Ol |