Online Database of Chemicals from Around the World
|
CAS#: 6682-67-3 Product: 1,1,4,6,7-Pentamethylindan No suppilers available for the product. |
| Name | 1,1,4,6,7-Pentamethylindan |
|---|---|
| Synonyms | 1,1,4,6,7-Pentamethylindane; 1H-Indene, 2,3-Dihydro-1,1,4,6,7-Pentamethyl; 1,1,4,6,7-Pentamethylindan |
| Molecular Structure |  |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 |
| CAS Registry Number | 6682-67-3 |
| SMILES | C1=C(C2=C(C(=C1C)C)C(CC2)(C)C)C |
| InChI | 1S/C14H20/c1-9-8-10(2)12-6-7-14(4,5)13(12)11(9)3/h8H,6-7H2,1-5H3 |
| InChIKey | DKEQNICHDTZGAN-UHFFFAOYSA-N |
| Density | 0.915g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.941°C at 760 mmHg (Cal.) |
| Flash point | 100.546°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,4,6,7-Pentamethylindan |