Online Database of Chemicals from Around the World
|
CAS#: 62738-36-7 Product: 3,7,8,9,10-Pentamethylisoalloxazine No suppilers available for the product. |
| Name | 3,7,8,9,10-Pentamethylisoalloxazine |
|---|---|
| Synonyms | 3,7,8,9,10-Pentamethylbenzo[G]Pteridine-2,4-Quinone; 3,7,8,9,10-Pentamethylisoalloxazine; 3,7,8,9,10-Pmiao |
| Molecular Structure |  |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 |
| CAS Registry Number | 62738-36-7 |
| SMILES | C3=C2N=C1C(N(C(N=C1N(C2=C(C(=C3C)C)C)C)=O)C)=O |
| InChI | 1S/C15H16N4O2/c1-7-6-10-12(9(3)8(7)2)18(4)13-11(16-10)14(20)19(5)15(21)17-13/h6H,1-5H3 |
| InChIKey | SNXWLADGMUSAQF-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.09°C at 760 mmHg (Cal.) |
| Flash point | 228.426°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7,8,9,10-Pentamethylisoalloxazine |