Online Database of Chemicals from Around the World
|
CAS#: 5397-71-7 Product: 5-Amino-2,4-Dichlorophenoxyacetic Acid No suppilers available for the product. |
| Name | 5-Amino-2,4-Dichlorophenoxyacetic Acid |
|---|---|
| Synonyms | 2-(5-Amino-2,4-Dichloro-Phenoxy)Acetic Acid; 2-(5-Amino-2,4-Dichloro-Phenoxy)Ethanoic Acid; Nsc4250 |
| Molecular Structure |  |
| Molecular Formula | C8H7Cl2NO3 |
| Molecular Weight | 236.05 |
| CAS Registry Number | 5397-71-7 |
| EINECS | 226-423-2 |
| SMILES | C1=C(OCC(O)=O)C(=CC(=C1N)Cl)Cl |
| InChI | 1S/C8H7Cl2NO3/c9-4-1-5(10)7(2-6(4)11)14-3-8(12)13/h1-2H,3,11H2,(H,12,13) |
| InChIKey | VMNPETQUBQUXAP-UHFFFAOYSA-N |
| Density | 1.566g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.817°C at 760 mmHg (Cal.) |
| Flash point | 204.069°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-2,4-Dichlorophenoxyacetic Acid |