| Zhejiang Chempharm Industry&trading Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.chempharm.cn | |||
![]() | +86 (571) 8770-1568 | |||
![]() | export@chempharm.cn | |||
| Chemical distributor since 1996 | ||||
| chemBlink Standard supplier since 2007 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyridazine |
|---|---|
| Name | 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one |
| Synonyms | 3-(4-amino-2,6-dichlorophenoxy)-5-propan-2-yl-1H-pyridazin-6-one |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 |
| CAS Registry Number | 920509-28-0 |
| SMILES | CC(C)C1=CC(=NNC1=O)OC2=C(C=C(C=C2Cl)N)Cl |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
|
6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one is a synthetic compound known for its great potential in various fields, especially pharmaceutical and agricultural fields. The discovery of 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one stems from the efforts to develop new compounds with potent biological activities. Researchers aim to synthesize molecules with enhanced efficacy and specificity for therapeutic and agricultural applications. The synthesis involves strategic modification of pyridazinone derivatives, incorporating amino and chlorophenoxy groups to achieve the desired biological activity. 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one exhibits several key properties that make it valuable in various applications. Its molecular formula is C13H13Cl2N3O2 and its molecular weight is 318.17 g/mol. The structural features of this compound, including the pyridazinone ring and the dichlorophenoxy group, contribute to its stability and reactivity. Its solubility and interaction with biological targets are crucial to its efficacy in different uses. The main application of this compound is pharmaceuticals. It has shown promise as a therapeutic agent due to its potential to interact with specific biological targets. Studies have shown that it may be useful in treating various diseases, including cancer and inflammation. Its ability to modulate specific pathways and enzymes makes it a candidate for the development of new drugs with targeted effects. In agriculture, 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one is used as a herbicide. Its structure enables it to inhibit the growth of certain weeds without affecting crops. The selective herbicidal activity of this compound is beneficial for maintaining crop health and yield. Its efficacy in controlling weed populations has led to its adoption in agricultural practices to increase productivity and reduce crop losses due to weed competition. In addition to direct applications, this compound is also valuable in research and development. It is a lead compound for the development of new derivatives with enhanced properties. Researchers explore modifications to its structure to improve its bioactivity, selectivity, and safety. The synthesis of 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one is also of great significance in chemical research. Its synthesis involves advanced organic chemistry techniques that provide insights into the generation of complex molecules. The methods developed for its synthesis can be applied to other chemical processes, advancing the field of synthetic organic chemistry. The future of 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one lies in its further exploration through clinical trials and agricultural research. Understanding its pharmacokinetics, long-term effects, and environmental impacts are essential for its development and safe application. Innovations in synthetic methods and derivative development may enhance its efficacy and expand its use. References none |
| Market Analysis Reports |
| List of Reports Available for 6-(4-amino-2,6-dichlorophenoxy)-4-isopropylpyridazin-3(2H)-one |