Online Database of Chemicals from Around the World
|
CAS#: 570-94-5 Product: (17beta)-17-Hydroxyandrost-4-Ene-3,6-Dione No suppilers available for the product. |
| Name | (17beta)-17-Hydroxyandrost-4-Ene-3,6-Dione |
|---|---|
| Synonyms | 4-Androsten-17β-ol-3,6-dione |
| Molecular Structure |  |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 |
| CAS Registry Number | 570-94-5 |
| SMILES | C[C@]43CCC(=O)\C=C4\C(=O)C[C@@H]1[C@@H]3CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | 1S/C19H26O3/c1-18-7-5-11(20)9-15(18)16(21)10-12-13-3-4-17(22)19(13,2)8-6-14(12)18/h9,12-14,17,22H,3-8,10H2,1-2H3/t12-,13-,14-,17-,18+,19-/m0/s1 |
| InChIKey | HRCFICFHZXGNIJ-WERNOVKHSA-N |
| Density | 1.191g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.057°C at 760 mmHg (Cal.) |
| Flash point | 246.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (17beta)-17-Hydroxyandrost-4-Ene-3,6-Dione |