| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N,N-Dimethylaniline Hydrochloride |
|---|---|
| Synonyms | Dimethyl-Phenyl-Amine Hydrochloride; Benzenamine, N,N-Dimethyl-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 |
| CAS Registry Number | 5882-44-0 |
| EINECS | 227-555-3 |
| SMILES | [H+].C1=CC=C(C=C1)N(C)C.[Cl-] |
| InChI | 1S/C8H11N.ClH/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3;1H |
| InChIKey | WOAZEKPXTXCPFZ-UHFFFAOYSA-N |
| Boiling point | 193.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 62.8°C (Cal.) |
| (1) | Li Jia, Jiquan Zhao, Errun Ding and William W. Brennessel. Synthesis, structures, and alkene hydrosilation activities of neutral tripodal amidozirconium alkyls, Dalton Trans., 2002, 0, 2608. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethylaniline Hydrochloride |