Online Database of Chemicals from Around the World
|
CAS#: 594-91-2 Product: Perfluoro-2-Methylbutane No suppilers available for the product. |
| Name | Perfluoro-2-Methylbutane |
|---|---|
| Synonyms | Moli000989; Perflisopent; Butane, 1,1,1,2,3,3,4,4,4-Nonafluoro-2-(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C5F12 |
| Molecular Weight | 288.04 |
| CAS Registry Number | 594-91-2 |
| SMILES | FC(C(C(F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C5F12/c6-1(3(9,10)11,4(12,13)14)2(7,8)5(15,16)17 |
| InChIKey | MPEFSWGYIJNMCW-UHFFFAOYSA-N |
| Density | 1.63g/cm3 (Cal.) |
|---|---|
| Boiling point | 31.629°C at 760 mmHg (Cal.) |
| Flash point | -15.014°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Perfluoro-2-Methylbutane |