Online Database of Chemicals from Around the World
|
CAS#: 60096-00-6 Product: Perfluoromethyladamantane No suppilers available for the product. |
| Name | Perfluoromethyladamantane |
|---|---|
| Synonyms | Perfluoromethyladamantane; Tricyclo(3.3.1.1(3,7))Decane, 1,2,2,3,4,4,5,6,6,8,8,9,9,10,10-Pentadecafluoro-7-(Trifluoromethyl)-; 1,2,2,3,4,4,5,6,6,8,8,9,9,10,10-Pentadecafluoro-7-(Trifluoromethyl)Tricyclo[3.3.1.1(3,7)]Decane |
| Molecular Structure |  |
| Molecular Formula | C11F18 |
| Molecular Weight | 474.09 |
| CAS Registry Number | 60096-00-6 |
| SMILES | FC13C(F)(F)C2(C(F)(F)C(F)(C1(F)F)C(F)(F)C(F)(C2(F)F)C3(F)F)C(F)(F)F |
| InChI | 1S/C11F18/c12-2-5(15,16)1(11(27,28)29)6(17,18)3(13,8(2,21)22)10(25,26)4(14,7(1,19)20)9(2,23)24 |
| InChIKey | WKHMXCIUCCIPOU-UHFFFAOYSA-N |
| Density | 1.9g/cm3 (Cal.) |
|---|---|
| Boiling point | 126.942°C at 760 mmHg (Cal.) |
| Flash point | 40.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Perfluoromethyladamantane |