Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Perfluoroisoundecyl Iodide |
|---|---|
| Synonyms | Decane, 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-Eicosafluoro-10-Iodo-2-(Trifluoromethyl)-; Decane, Eicosafluoro-1-Iodo-9-(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C11F23I |
| Molecular Weight | 695.99 |
| CAS Registry Number | 677-93-0 |
| EINECS | 211-645-4 |
| SMILES | FC(C(C(C(C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C11F23I/c12-1(9(27,28)29,10(30,31)32)2(13,14)3(15,16)4(17,18)5(19,20)6(21,22)7(23,24)8(25,26)11(33,34)35 |
| InChIKey | ZBAGFGHCDOIBDJ-UHFFFAOYSA-N |
| Density | 1.962g/cm3 (Cal.) |
|---|---|
| Boiling point | 219.603°C at 760 mmHg (Cal.) |
| Flash point | 101.411°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Perfluoroisoundecyl Iodide |