Online Database of Chemicals from Around the World
|
CAS#: 61931-72-4 Product: 4-(2,5-Xylylazo)-o-Toluidine No suppilers available for the product. |
| Name | 4-(2,5-Xylylazo)-o-Toluidine |
|---|---|
| Synonyms | 4-(2,5-Dimethylphenyl)Azo-3-Methyl-Aniline; 4-(2,5-Dimethylphenyl)Azo-3-Methylaniline; [4-(2,5-Dimethylphenyl)Azo-3-Methyl-Phenyl]Amine |
| Molecular Structure |  |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 |
| CAS Registry Number | 61931-72-4 |
| EINECS | 263-332-7 |
| SMILES | C1=C(C=CC(=C1N=NC2=C(C=C(N)C=C2)C)C)C |
| InChI | 1S/C15H17N3/c1-10-4-5-11(2)15(8-10)18-17-14-7-6-13(16)9-12(14)3/h4-9H,16H2,1-3H3 |
| InChIKey | OETSEAZERPXVGD-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.828°C at 760 mmHg (Cal.) |
| Flash point | 214.358°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,5-Xylylazo)-o-Toluidine |