Online Database of Chemicals from Around the World
|
CAS#: 62072-89-3 Product: 4-(Xylylazo)Xylidine No suppilers available for the product. |
| Name | 4-(Xylylazo)Xylidine |
|---|---|
| Synonyms | 4-(2,4-Dimethylphenyl)Azo-4,6-Dimethyl-Cyclohexa-1,5-Dien-1-Amine; 4-(2,4-Dimethylphenyl)Azo-4,6-Dimethyl-1-Cyclohexa-1,5-Dienamine; [4-(2,4-Dimethylphenyl)Azo-4,6-Dimethyl-1-Cyclohexa-1,5-Dienyl]Amine |
| Molecular Structure |  |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 |
| CAS Registry Number | 62072-89-3 |
| EINECS | 263-397-1 |
| SMILES | C2=C(N=NC1(C=C(C(=CC1)N)C)C)C(=CC(=C2)C)C |
| InChI | 1S/C16H21N3/c1-11-5-6-15(12(2)9-11)18-19-16(4)8-7-14(17)13(3)10-16/h5-7,9-10H,8,17H2,1-4H3 |
| InChIKey | PKTAGGFHZQMHSY-UHFFFAOYSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.627°C at 760 mmHg (Cal.) |
| Flash point | 190.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Xylylazo)Xylidine |