Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-(2,-Xylyl)Biguanide |
|---|---|
| Synonyms | 1-Amidino-1-(2,3-Dimethylphenyl)Guanidine; Imidodicarbonimidic Diamide, N-(2,?-Dimethylphenyl)-; 1-(2,-Xylyl)Biguanide |
| Molecular Structure |  |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 |
| CAS Registry Number | 68015-71-4 |
| EINECS | 268-143-3 |
| SMILES | C1=CC=C(N(C(N)=N)C(N)=N)C(=C1C)C |
| InChI | 1S/C10H15N5/c1-6-4-3-5-8(7(6)2)15(9(11)12)10(13)14/h3-5H,1-2H3,(H3,11,12)(H3,13,14) |
| InChIKey | MKBUFYMAJHFTJK-UHFFFAOYSA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.199°C at 760 mmHg (Cal.) |
| Flash point | 166.804°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,-Xylyl)Biguanide |