Online Database of Chemicals from Around the World
|
CAS#: 62278-92-6 Product: Strychnofendlerine No suppilers available for the product. |
| Name | Strychnofendlerine |
|---|---|
| Synonyms | Nsc301744; Strychnofendlerine |
| Molecular Structure |  |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.47 |
| CAS Registry Number | 62278-92-6 |
| SMILES | C1=C2C(=CC=C1)C45C(N2C(=O)C)C3COC(C(C3CC4=O)CN(CC5)C)C |
| InChI | 1S/C22H28N2O3/c1-13-16-11-23(3)9-8-22-18-6-4-5-7-19(18)24(14(2)25)21(22)17(12-27-13)15(16)10-20(22)26/h4-7,13,15-17,21H,8-12H2,1-3H3 |
| InChIKey | FMZMLKGLGADCPQ-UHFFFAOYSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.342°C at 760 mmHg (Cal.) |
| Flash point | 307.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Strychnofendlerine |