|
CAS#: 66-32-0 Product: Strychnine Nitrate No suppilers available for the product. |
| Classification | API >> Nervous system medication >> Central stimulant |
|---|---|
| Name | Strychnine Nitrate |
| Synonyms | Strychnine Nitrate; Strychnidin-10-One Mononitrate; Strychnine, Mononitrate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 |
| CAS Registry Number | 66-32-0 |
| EINECS | 200-627-1 |
| SMILES | [C@@H]17[NH+]4CC6=CCOC5CC(N2C([C@@]1(C3=CC=CC=C23)CC4)[C@H]5[C@H]6C7)=O.O=[N+]([O-])[O-] |
| InChI | 1S/C21H22N2O2.NO3/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21;2-1(3)4/h1-5,13,16-17,19-20H,6-11H2;/q;-1/p+1/t13-,16?,17-,19-,20?,21+;/m0./s1 |
| InChIKey | JWKVPTXNWFCSIW-OFWMIIDDSA-O |
| Boiling point | 559.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 292.4°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Strychnine Nitrate |