Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Organic raw materials >> Inorganic acid ester |
|---|---|
| Name | 1,3-Dinitroglycerin |
| Synonyms | (2-Hydroxy-3-Nitrooxy-Propyl) Nitrate; Nitric Acid (2-Hydroxy-3-Nitrooxypropyl) Ester; Nitric Acid (2-Hydroxy-3-Nitrooxy-Propyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C3H6N2O7 |
| Molecular Weight | 182.09 |
| CAS Registry Number | 623-87-0 |
| SMILES | C(O[N+]([O-])=O)C(O)CO[N+]([O-])=O |
| InChI | 1S/C3H6N2O7/c6-3(1-11-4(7)8)2-12-5(9)10/h3,6H,1-2H2 |
| InChIKey | ASIGVDLTBLZXNC-UHFFFAOYSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 170.235°C at 760 mmHg (Cal.) |
| Flash point | 56.757°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dinitroglycerin |