Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4,5-Dinitro-2H-imidazole |
|---|---|
| Synonyms | 2H-Imidazole, 4,5-dinitro-; 4,5-Dinitro-2H-imidazol; 4,5-Dinitro-2H-imidazole |
| Molecular Structure |  |
| Molecular Formula | C3H2N4O4 |
| Molecular Weight | 158.07 |
| CAS Registry Number | 940948-16-3 |
| SMILES | C1N=C(C(=N1)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | 1S/C3H2N4O4/c8-6(9)2-3(7(10)11)5-1-4-2/h1H2 |
| InChIKey | QBDHNDZSOHWVOJ-UHFFFAOYSA-N |
| Density | 2.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.5±25.0°C at 760 mmHg (Cal.) |
| Flash point | 171.8±23.2°C (Cal.) |
| Refractive index | 1.81 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dinitro-2H-imidazole |