Online Database of Chemicals from Around the World
|
CAS#: 71888-61-4 Product: 1,2-Di-O-nitro-D-glucitol No suppilers available for the product. |
| Name | 1,2-Di-O-nitro-D-glucitol |
|---|---|
| Synonyms | D-glucitol dinitrate |
| Molecular Structure |  |
| Molecular Formula | C6H12N2O10 |
| Molecular Weight | 272.17 |
| CAS Registry Number | 71888-61-4 |
| EINECS | 276-150-8 |
| SMILES | O=[N+]([O-])OC[C@H](O[N+](=O)[O-])[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | 1S/C6H12N2O10/c9-1-3(10)5(11)6(12)4(18-8(15)16)2-17-7(13)14/h3-6,9-12H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | ZNWGJVKCVWQWPY-JGWLITMVSA-N |
| Density | 1.729g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.167°C at 760 mmHg (Cal.) |
| Flash point | 235.125°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Di-O-nitro-D-glucitol |